C38H54N4O5 — CID 91053876
3-hexyl-6-[2-[2-[3-hexyl-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]ethyl]-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexane (PubChem CID 91053876) has the molecular formula C38H54N4O5 and a molecular weight of 646.87 g/mol. Its IUPAC name is 3-hexyl-6-[2-[2-[3-hexyl-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]ethyl]-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-hexyl-6-[2-[2-[3-hexyl-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]ethyl]-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 91053876 |
| Molecular Formula | C38H54N4O5 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.41 |
| IUPAC Name | 3-hexyl-6-[2-[2-[3-hexyl-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexan-6-yl]ethoxy]ethyl]-6-(3-nitrophenyl)-3-azabicyclo[3.1.0]hexane |
| SMILES | CCCCCCN1CC2C(C1)C2(CCOCCC1(c2cccc([N+](=O)[O-])c2)C2CN(CCCCCC)CC21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H54N4O5/c1-3-5-7-9-19-39-25-33-34(26-39)37(33,29-13-11-15-31(23-29)41(43)44)17-21-47-22-18-38(30-14-12-16-32(24-30)42(45)46)35-27-40(28-36(35)38)20-10-8-6-4-2/h11-16,23-24,33-36H,3-10,17-22,25-28H2,1-2H3 |
| InChIKey | BBKWUVGXSVFTHC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|