C15H22N2O4 — CID 2995034
2,6-dimethyl-4-[3-(3-nitrophenoxy)propyl]morpholine (PubChem CID 2995034) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-(3-nitrophenoxy)propyl]morpholine.
| Compound Name | 2,6-dimethyl-4-[3-(3-nitrophenoxy)propyl]morpholine |
|---|---|
| PubChem CID | 2995034 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2,6-dimethyl-4-[3-(3-nitrophenoxy)propyl]morpholine |
| SMILES | CC1CN(CCCOc2cccc([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C15H22N2O4/c1-12-10-16(11-13(2)21-12)7-4-8-20-15-6-3-5-14(9-15)17(18)19/h3,5-6,9,12-13H,4,7-8,10-11H2,1-2H3 |
| InChIKey | OUVPJANJTOYHRA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|