C15H24N2O2 — CID 43365509
3-[3-(2,6-dimethylmorpholin-4-yl)propoxy]aniline (PubChem CID 43365509) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-[3-(2,6-dimethylmorpholin-4-yl)propoxy]aniline.
| Compound Name | 3-[3-(2,6-dimethylmorpholin-4-yl)propoxy]aniline |
|---|---|
| PubChem CID | 43365509 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-[3-(2,6-dimethylmorpholin-4-yl)propoxy]aniline |
| SMILES | CC1CN(CCCOc2cccc(N)c2)CC(C)O1 |
| InChI | InChI=1S/C15H24N2O2/c1-12-10-17(11-13(2)19-12)7-4-8-18-15-6-3-5-14(16)9-15/h3,5-6,9,12-13H,4,7-8,10-11,16H2,1-2H3 |
| InChIKey | DKZRBDBKWMXYFJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|