C18H28ClNO2 — CID 2993601
4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-2,6-dimethylmorpholine;hydrochloride (PubChem CID 2993601) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-2,6-dimethylmorpholine;hydrochloride.
| Compound Name | 4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-2,6-dimethylmorpholine;hydrochloride |
|---|---|
| PubChem CID | 2993601 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-2,6-dimethylmorpholine;hydrochloride |
| SMILES | CC1CN(CCCOc2ccc3c(c2)CCC3)CC(C)O1.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-14-12-19(13-15(2)21-14)9-4-10-20-18-8-7-16-5-3-6-17(16)11-18;/h7-8,11,14-15H,3-6,9-10,12-13H2,1-2H3;1H |
| InChIKey | IDCWCVLXRNNEJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|