C23H31ClN2O2 — CID 45260980
1-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-4-(4-methoxyphenyl)piperazine;hydrochloride (PubChem CID 45260980) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-4-(4-methoxyphenyl)piperazine;hydrochloride.
| Compound Name | 1-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-4-(4-methoxyphenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 45260980 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]-4-(4-methoxyphenyl)piperazine;hydrochloride |
| SMILES | COc1ccc(N2CCN(CCCOc3ccc4c(c3)CCC4)CC2)cc1.Cl |
| InChI | InChI=1S/C23H30N2O2.ClH/c1-26-22-10-7-21(8-11-22)25-15-13-24(14-16-25)12-3-17-27-23-9-6-19-4-2-5-20(19)18-23;/h6-11,18H,2-5,12-17H2,1H3;1H |
| InChIKey | CMFLTHXCRFRWRT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|