C24H33N3O3 — CID 135339905
7-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-1-ol (PubChem CID 135339905) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 7-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-1-ol.
| Compound Name | 7-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-1-ol |
|---|---|
| PubChem CID | 135339905 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 7-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]-2-methyl-3,4-dihydro-1H-isoquinolin-1-ol |
| SMILES | COc1ccc(N2CCN(CCCOc3ccc4c(c3)C(O)N(C)CC4)CC2)cc1 |
| InChI | InChI=1S/C24H33N3O3/c1-25-12-10-19-4-7-22(18-23(19)24(25)28)30-17-3-11-26-13-15-27(16-14-26)20-5-8-21(29-2)9-6-20/h4-9,18,24,28H,3,10-17H2,1-2H3 |
| InChIKey | HBRPFMWNEMEADU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|