C24H30N2O3 — CID 20532689
[4-[4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]piperazin-1-yl]phenyl] acetate (PubChem CID 20532689) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is [4-[4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]piperazin-1-yl]phenyl] acetate.
| Compound Name | [4-[4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]piperazin-1-yl]phenyl] acetate |
|---|---|
| PubChem CID | 20532689 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [4-[4-[3-(2,3-dihydro-1H-inden-5-yloxy)propyl]piperazin-1-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2CCN(CCCOc3ccc4c(c3)CCC4)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-19(27)29-23-10-7-22(8-11-23)26-15-13-25(14-16-26)12-3-17-28-24-9-6-20-4-2-5-21(20)18-24/h6-11,18H,2-5,12-17H2,1H3 |
| InChIKey | DZJGVXTWLFUCHK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|