C24H33ClN2O — CID 45260941
1-[5-(2,3-dihydro-1H-inden-5-yloxy)pentyl]-4-phenylpiperazine;hydrochloride (PubChem CID 45260941) has the molecular formula C24H33ClN2O and a molecular weight of 400.99 g/mol. Its IUPAC name is 1-[5-(2,3-dihydro-1H-inden-5-yloxy)pentyl]-4-phenylpiperazine;hydrochloride.
| Compound Name | 1-[5-(2,3-dihydro-1H-inden-5-yloxy)pentyl]-4-phenylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 45260941 |
| Molecular Formula | C24H33ClN2O |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[5-(2,3-dihydro-1H-inden-5-yloxy)pentyl]-4-phenylpiperazine;hydrochloride |
| SMILES | Cl.c1ccc(N2CCN(CCCCCOc3ccc4c(c3)CCC4)CC2)cc1 |
| InChI | InChI=1S/C24H32N2O.ClH/c1-3-10-23(11-4-1)26-17-15-25(16-18-26)14-5-2-6-19-27-24-13-12-21-8-7-9-22(21)20-24;/h1,3-4,10-13,20H,2,5-9,14-19H2;1H |
| InChIKey | YWAQALJZUIGISS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|