C19H32ClN3O3 — CID 141019584
1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol;hydrochloride (PubChem CID 141019584) has the molecular formula C19H32ClN3O3 and a molecular weight of 385.94 g/mol. Its IUPAC name is 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol;hydrochloride.
| Compound Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol;hydrochloride |
|---|---|
| PubChem CID | 141019584 |
| Molecular Formula | C19H32ClN3O3 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 1-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]piperidine-2,6-diol;hydrochloride |
| SMILES | COc1ccc(N2CCN(CCCN3C(O)CCCC3O)CC2)cc1.Cl |
| InChI | InChI=1S/C19H31N3O3.ClH/c1-25-17-8-6-16(7-9-17)21-14-12-20(13-15-21)10-3-11-22-18(23)4-2-5-19(22)24;/h6-9,18-19,23-24H,2-5,10-15H2,1H3;1H |
| InChIKey | VSOGXAFHHKEFOX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|