C19H32IN5O — CID 110029609
1-cyclopropyl-2-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide (PubChem CID 110029609) has the molecular formula C19H32IN5O and a molecular weight of 473.40 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110029609 |
| Molecular Formula | C19H32IN5O |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 1-cyclopropyl-2-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-1-methylguanidine;hydroiodide |
| SMILES | COc1ccc(N2CCN(CCC/N=C(\N)N(C)C3CC3)CC2)cc1.I |
| InChI | InChI=1S/C19H31N5O.HI/c1-22(16-4-5-16)19(20)21-10-3-11-23-12-14-24(15-13-23)17-6-8-18(25-2)9-7-17;/h6-9,16H,3-5,10-15H2,1-2H3,(H2,20,21);1H |
| InChIKey | JBBIRYIYYDZRTK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|