C23H32IN5 — CID 110030146
1-cyclopropyl-1-methyl-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 110030146) has the molecular formula C23H32IN5 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110030146 |
| Molecular Formula | C23H32IN5 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/Cc1ccccc1CN1CCN(c2ccccc2)CC1)C1CC1.I |
| InChI | InChI=1S/C23H31N5.HI/c1-26(21-11-12-21)23(24)25-17-19-7-5-6-8-20(19)18-27-13-15-28(16-14-27)22-9-3-2-4-10-22;/h2-10,21H,11-18H2,1H3,(H2,24,25);1H |
| InChIKey | ZKNJNBPGTJSTQM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|