C25H31N5S — CID 111061885
2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111061885) has the molecular formula C25H31N5S and a molecular weight of 433.63 g/mol. Its IUPAC name is 2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111061885 |
| Molecular Formula | C25H31N5S |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 2-[[2-[(4-phenylpiperazin-1-yl)methyl]phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\Cc1ccccc1CN1CCN(c2ccccc2)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C25H31N5S/c26-25(27-13-12-24-11-6-18-31-24)28-19-21-7-4-5-8-22(21)20-29-14-16-30(17-15-29)23-9-2-1-3-10-23/h1-11,18H,12-17,19-20H2,(H3,26,27,28) |
| InChIKey | FALZIZANWAQOGA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|