C22H29N7S — CID 111493376
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-N-(2-thiophen-2-ylethyl)piperazine-1-carboximidamide (PubChem CID 111493376) has the molecular formula C22H29N7S and a molecular weight of 423.59 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-N-(2-thiophen-2-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-N-(2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493376 |
| Molecular Formula | C22H29N7S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-phenyl-N-(2-thiophen-2-ylethyl)piperazine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCCc2cccs2)N2CCN(c3ccccc3)CC2)n1C |
| InChI | InChI=1S/C22H29N7S/c1-18-25-26-21(27(18)2)17-24-22(23-11-10-20-9-6-16-30-20)29-14-12-28(13-15-29)19-7-4-3-5-8-19/h3-9,16H,10-15,17H2,1-2H3,(H,23,24) |
| InChIKey | ZCPIOFNDGGVARG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|