C18H27FIN7 — CID 111165296
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165296) has the molecular formula C18H27FIN7 and a molecular weight of 487.37 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165296 |
| Molecular Formula | C18H27FIN7 |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C18H26FN7.HI/c1-4-20-18(21-13-17-23-22-14(2)24(17)3)26-11-9-25(10-12-26)16-7-5-15(19)6-8-16;/h5-8H,4,9-13H2,1-3H3,(H,20,21);1H |
| InChIKey | SZBGTWZFGBNVEV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|