C23H30FN5O — CID 111164905
4-[[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111164905) has the molecular formula C23H30FN5O and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-[[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111164905 |
| Molecular Formula | C23H30FN5O |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-[[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30FN5O/c1-4-25-23(26-17-18-5-7-19(8-6-18)22(30)27(2)3)29-15-13-28(14-16-29)21-11-9-20(24)10-12-21/h5-12H,4,13-17H2,1-3H3,(H,25,26) |
| InChIKey | PEGONWLHGFSHFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|