C25H34N4O — CID 111152426
4-[[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111152426) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111152426 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 4-[[[(4-benzylpiperidin-1-yl)-(ethylamino)methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N4O/c1-4-26-25(27-19-22-10-12-23(13-11-22)24(30)28(2)3)29-16-14-21(15-17-29)18-20-8-6-5-7-9-20/h5-13,21H,4,14-19H2,1-3H3,(H,26,27) |
| InChIKey | KUNSQBOGHVVXBD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|