C16H27IN6OS — CID 111907354
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111907354) has the molecular formula C16H27IN6OS and a molecular weight of 478.40 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111907354 |
| Molecular Formula | C16H27IN6OS |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-ethoxyethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCOCCN/C(=N\Cc1nnc(C)n1C)NCCc1cccs1.I |
| InChI | InChI=1S/C16H26N6OS.HI/c1-4-23-10-9-18-16(17-8-7-14-6-5-11-24-14)19-12-15-21-20-13(2)22(15)3;/h5-6,11H,4,7-10,12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | KTRLWOBSYFJAMN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|