C23H32N6OS — CID 111871655
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(1-phenylethoxy)propyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111871655) has the molecular formula C23H32N6OS and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(1-phenylethoxy)propyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(1-phenylethoxy)propyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111871655 |
| Molecular Formula | C23H32N6OS |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(1-phenylethoxy)propyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(/NCCCOC(C)c2ccccc2)NCCc2cccs2)n1C |
| InChI | InChI=1S/C23H32N6OS/c1-18(20-9-5-4-6-10-20)30-15-8-13-24-23(25-14-12-21-11-7-16-31-21)26-17-22-28-27-19(2)29(22)3/h4-7,9-11,16,18H,8,12-15,17H2,1-3H3,(H2,24,25,26) |
| InChIKey | UNWGQDDMQUBFBK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|