C26H37IN6O — CID 111233668
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3,3-diphenylpropyl)-3-(3-ethoxypropyl)guanidine;hydroiodide (PubChem CID 111233668) has the molecular formula C26H37IN6O and a molecular weight of 576.53 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3,3-diphenylpropyl)-3-(3-ethoxypropyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3,3-diphenylpropyl)-3-(3-ethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111233668 |
| Molecular Formula | C26H37IN6O |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3,3-diphenylpropyl)-3-(3-ethoxypropyl)guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NCCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C26H36N6O.HI/c1-4-33-19-11-17-27-26(29-20-25-31-30-21(2)32(25)3)28-18-16-24(22-12-7-5-8-13-22)23-14-9-6-10-15-23;/h5-10,12-15,24H,4,11,16-20H2,1-3H3,(H2,27,28,29);1H |
| InChIKey | RZOHSINAMHKLBA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|