C23H39IN6O — CID 111549561
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111549561) has the molecular formula C23H39IN6O and a molecular weight of 542.51 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111549561 |
| Molecular Formula | C23H39IN6O |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-ethoxypropyl)-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NCCCc1ccc(C(C)C)cc1.I |
| InChI | InChI=1S/C23H38N6O.HI/c1-6-30-16-8-15-25-23(26-17-22-28-27-19(4)29(22)5)24-14-7-9-20-10-12-21(13-11-20)18(2)3;/h10-13,18H,6-9,14-17H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | FWXISJOMBZFAQC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|