C19H30ClIN6O — CID 111319457
1-[1-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide (PubChem CID 111319457) has the molecular formula C19H30ClIN6O and a molecular weight of 520.85 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111319457 |
| Molecular Formula | C19H30ClIN6O |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NC(C)c1ccccc1Cl.I |
| InChI | InChI=1S/C19H29ClN6O.HI/c1-5-27-12-8-11-21-19(22-13-18-25-24-15(3)26(18)4)23-14(2)16-9-6-7-10-17(16)20;/h6-7,9-10,14H,5,8,11-13H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | MMJOGMGZUJCQPE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|