C18H28BrIN6 — CID 111322213
1-[1-(2-bromophenyl)ethyl]-3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111322213) has the molecular formula C18H28BrIN6 and a molecular weight of 535.27 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111322213 |
| Molecular Formula | C18H28BrIN6 |
| Molecular Weight | 535.27 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NC(C)c1ccccc1Br.I |
| InChI | InChI=1S/C18H27BrN6.HI/c1-5-6-11-20-18(21-12-17-24-23-14(3)25(17)4)22-13(2)15-9-7-8-10-16(15)19;/h7-10,13H,5-6,11-12H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | PZCPWPGSZQKSHM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|