C19H29FN6O — CID 111684562
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(2-fluorophenoxy)propyl]guanidine (PubChem CID 111684562) has the molecular formula C19H29FN6O and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(2-fluorophenoxy)propyl]guanidine.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(2-fluorophenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111684562 |
| Molecular Formula | C19H29FN6O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(2-fluorophenoxy)propyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCC(C)Oc1ccccc1F |
| InChI | InChI=1S/C19H29FN6O/c1-5-6-11-21-19(23-13-18-25-24-15(3)26(18)4)22-12-14(2)27-17-10-8-7-9-16(17)20/h7-10,14H,5-6,11-13H2,1-4H3,(H2,21,22,23) |
| InChIKey | PFXOIKJESJLPIV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|