C19H38N6 — CID 111204896
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(7-methyloctyl)guanidine (PubChem CID 111204896) has the molecular formula C19H38N6 and a molecular weight of 350.56 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(7-methyloctyl)guanidine.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(7-methyloctyl)guanidine |
|---|---|
| PubChem CID | 111204896 |
| Molecular Formula | C19H38N6 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.32 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(7-methyloctyl)guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCCCCCCC(C)C |
| InChI | InChI=1S/C19H38N6/c1-6-7-13-20-19(21-14-11-9-8-10-12-16(2)3)22-15-18-24-23-17(4)25(18)5/h16H,6-15H2,1-5H3,(H2,20,21,22) |
| InChIKey | XUAJOFBDNNIUAD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|