C16H29N7O — CID 111927291
N-[2-[[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111927291) has the molecular formula C16H29N7O and a molecular weight of 335.46 g/mol. Its IUPAC name is N-[2-[[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111927291 |
| Molecular Formula | C16H29N7O |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | N-[2-[[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C16H29N7O/c1-4-5-8-18-16(19-10-9-17-15(24)13-6-7-13)20-11-14-22-21-12(2)23(14)3/h13H,4-11H2,1-3H3,(H,17,24)(H2,18,19,20) |
| InChIKey | CKVKZXNQRADVNF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|