C19H29FN6S — CID 111311530
1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine (PubChem CID 111311530) has the molecular formula C19H29FN6S and a molecular weight of 392.55 g/mol. Its IUPAC name is 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine.
| Compound Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
|---|---|
| PubChem CID | 111311530 |
| Molecular Formula | C19H29FN6S |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN6S/c1-4-5-11-21-19(23-14-18-25-24-15(2)26(18)3)22-12-6-13-27-17-9-7-16(20)8-10-17/h7-10H,4-6,11-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | YARCWPYAQKEHRQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|