C17H22F3N5O — CID 111685110
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2-fluorophenoxy)propyl]guanidine (PubChem CID 111685110) has the molecular formula C17H22F3N5O and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2-fluorophenoxy)propyl]guanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2-fluorophenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111685110 |
| Molecular Formula | C17H22F3N5O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2-fluorophenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCC(C)Oc1ccccc1F |
| InChI | InChI=1S/C17H22F3N5O/c1-3-21-17(24-11-15-22-8-9-25(15)16(19)20)23-10-12(2)26-14-7-5-4-6-13(14)18/h4-9,12,16H,3,10-11H2,1-2H3,(H2,21,23,24) |
| InChIKey | HVRATDWUMXJLGJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|