C23H27F2N5 — CID 111233663
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(3,3-diphenylpropyl)-3-ethylguanidine (PubChem CID 111233663) has the molecular formula C23H27F2N5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(3,3-diphenylpropyl)-3-ethylguanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(3,3-diphenylpropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111233663 |
| Molecular Formula | C23H27F2N5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-(3,3-diphenylpropyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27F2N5/c1-2-26-23(29-17-21-27-15-16-30(21)22(24)25)28-14-13-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,15-16,20,22H,2,13-14,17H2,1H3,(H2,26,28,29) |
| InChIKey | YCFPHDPJWASDGX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|