C16H18Cl3F2N5O — CID 109464352
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine (PubChem CID 109464352) has the molecular formula C16H18Cl3F2N5O and a molecular weight of 440.71 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 109464352 |
| Molecular Formula | C16H18Cl3F2N5O |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(2,4,6-trichlorophenoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl3F2N5O/c1-2-22-16(25-9-13-23-3-5-26(13)15(20)21)24-4-6-27-14-11(18)7-10(17)8-12(14)19/h3,5,7-8,15H,2,4,6,9H2,1H3,(H2,22,24,25) |
| InChIKey | OPGXVRJBECANSF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|