C19H24F2IN7 — CID 111851519
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111851519) has the molecular formula C19H24F2IN7 and a molecular weight of 515.35 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111851519 |
| Molecular Formula | C19H24F2IN7 |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-2-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cn1cccn1)NCc1nccn1C(F)F.I |
| InChI | InChI=1S/C19H23F2N7.HI/c1-2-22-19(25-13-17-23-9-11-28(17)18(20)21)24-12-15-6-3-4-7-16(15)14-27-10-5-8-26-27;/h3-11,18H,2,12-14H2,1H3,(H2,22,24,25);1H |
| InChIKey | YZCMVQFZUJKSOK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|