C17H23F2N5 — CID 111938481
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine (PubChem CID 111938481) has the molecular formula C17H23F2N5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111938481 |
| Molecular Formula | C17H23F2N5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-[(2,4-dimethylphenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1C)NCc1nccn1C(F)F |
| InChI | InChI=1S/C17H23F2N5/c1-4-20-17(22-10-14-6-5-12(2)9-13(14)3)23-11-15-21-7-8-24(15)16(18)19/h5-9,16H,4,10-11H2,1-3H3,(H2,20,22,23) |
| InChIKey | ZBIXVEJBEWUJCM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|