C19H28F2IN5O2 — CID 109491581
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109491581) has the molecular formula C19H28F2IN5O2 and a molecular weight of 523.37 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109491581 |
| Molecular Formula | C19H28F2IN5O2 |
| Molecular Weight | 523.37 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCC(O)c1cccc(OC(C)C)c1.I |
| InChI | InChI=1S/C19H27F2N5O2.HI/c1-4-22-19(25-12-17-23-8-9-26(17)18(20)21)24-11-16(27)14-6-5-7-15(10-14)28-13(2)3;/h5-10,13,16,18,27H,4,11-12H2,1-3H3,(H2,22,24,25);1H |
| InChIKey | IFZBKKACXAUULJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|