C20H31IN4O2S — CID 109491944
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109491944) has the molecular formula C20H31IN4O2S and a molecular weight of 518.47 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109491944 |
| Molecular Formula | C20H31IN4O2S |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCC(O)c1cccc(OC(C)C)c1.I |
| InChI | InChI=1S/C20H30N4O2S.HI/c1-5-17-11-22-19(27-17)13-24-20(21-6-2)23-12-18(25)15-8-7-9-16(10-15)26-14(3)4;/h7-11,14,18,25H,5-6,12-13H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | SFSMOIPOMIRALZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|