C16H23BrN6 — CID 111322204
1-[1-(2-bromophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine (PubChem CID 111322204) has the molecular formula C16H23BrN6 and a molecular weight of 379.31 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine.
| Compound Name | 1-[1-(2-bromophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111322204 |
| Molecular Formula | C16H23BrN6 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[1-(2-bromophenyl)ethyl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NC(C)c1ccccc1Br |
| InChI | InChI=1S/C16H23BrN6/c1-5-18-16(19-10-15-22-21-12(3)23(15)4)20-11(2)13-8-6-7-9-14(13)17/h6-9,11H,5,10H2,1-4H3,(H2,18,19,20) |
| InChIKey | LNTQRZOJXGGUIZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|