C20H39IN6O2 — CID 111397413
1-(3-cyclohexyloxypropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide (PubChem CID 111397413) has the molecular formula C20H39IN6O2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111397413 |
| Molecular Formula | C20H39IN6O2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NCCCOC1CCCCC1.I |
| InChI | InChI=1S/C20H38N6O2.HI/c1-4-27-14-8-12-21-20(23-16-19-25-24-17(2)26(19)3)22-13-9-15-28-18-10-6-5-7-11-18;/h18H,4-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | HKXWLNNFDXORAU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|