C16H30N6O — CID 110990909
1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine (PubChem CID 110990909) has the molecular formula C16H30N6O and a molecular weight of 322.46 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine.
| Compound Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 110990909 |
| Molecular Formula | C16H30N6O |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)NC1CCCC1 |
| InChI | InChI=1S/C16H30N6O/c1-4-23-11-7-10-17-16(19-14-8-5-6-9-14)18-12-15-21-20-13(2)22(15)3/h14H,4-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | RAFTYAGRGUFSHW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|