C18H34IN7O — CID 110990910
1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110990910) has the molecular formula C18H34IN7O and a molecular weight of 491.42 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110990910 |
| Molecular Formula | C18H34IN7O |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCCCN2CCOCC2)NC2CCCC2)n1C.I |
| InChI | InChI=1S/C18H33N7O.HI/c1-15-22-23-17(24(15)2)14-20-18(21-16-6-3-4-7-16)19-8-5-9-25-10-12-26-13-11-25;/h16H,3-14H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | SNTJIOFTLZPQBA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|