C20H37N7O2 — CID 111657900
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111657900) has the molecular formula C20H37N7O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111657900 |
| Molecular Formula | C20H37N7O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCC(C)(O)CN2CCOCC2)NC2CCCCC2)n1C |
| InChI | InChI=1S/C20H37N7O2/c1-16-24-25-18(26(16)3)13-21-19(23-17-7-5-4-6-8-17)22-14-20(2,28)15-27-9-11-29-12-10-27/h17,28H,4-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | WSVAHYZZAAONNM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|