C24H43N7 — CID 111292667
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine (PubChem CID 111292667) has the molecular formula C24H43N7 and a molecular weight of 429.66 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111292667 |
| Molecular Formula | C24H43N7 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(1-piperidin-1-ylcyclohexyl)methyl]guanidine |
| SMILES | Cc1nnc(C/N=C(/NCC2(N3CCCCC3)CCCCC2)NC2CCCCC2)n1C |
| InChI | InChI=1S/C24H43N7/c1-20-28-29-22(30(20)2)18-25-23(27-21-12-6-3-7-13-21)26-19-24(14-8-4-9-15-24)31-16-10-5-11-17-31/h21H,3-19H2,1-2H3,(H2,25,26,27) |
| InChIKey | WHNJKHKAJMDBOH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|