C19H37IN6O — CID 111710536
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide (PubChem CID 111710536) has the molecular formula C19H37IN6O and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111710536 |
| Molecular Formula | C19H37IN6O |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(2-methoxy-3,3-dimethylbutyl)guanidine;hydroiodide |
| SMILES | COC(CN/C(=N\Cc1nnc(C)n1C)NC1CCCCC1)C(C)(C)C.I |
| InChI | InChI=1S/C19H36N6O.HI/c1-14-23-24-17(25(14)5)13-21-18(22-15-10-8-7-9-11-15)20-12-16(26-6)19(2,3)4;/h15-16H,7-13H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | GRXZCKXPSWWEQM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|