C21H30F3IN6 — CID 111295864
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295864) has the molecular formula C21H30F3IN6 and a molecular weight of 550.41 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295864 |
| Molecular Formula | C21H30F3IN6 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCCc2ccc(C(F)(F)F)cc2)NC2CCCCC2)n1C.I |
| InChI | InChI=1S/C21H29F3N6.HI/c1-15-28-29-19(30(15)2)14-26-20(27-18-6-4-3-5-7-18)25-13-12-16-8-10-17(11-9-16)21(22,23)24;/h8-11,18H,3-7,12-14H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | KHAHNQFATCIOMF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|