C21H30IN7 — CID 111840953
1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111840953) has the molecular formula C21H30IN7 and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111840953 |
| Molecular Formula | C21H30IN7 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-cyclopentyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCCc2c[nH]c3ccccc23)NC2CCCC2)n1C.I |
| InChI | InChI=1S/C21H29N7.HI/c1-15-26-27-20(28(15)2)14-24-21(25-17-7-3-4-8-17)22-12-11-16-13-23-19-10-6-5-9-18(16)19;/h5-6,9-10,13,17,23H,3-4,7-8,11-12,14H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | JISUZBDEPRECDG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|