C23H33N7 — CID 111342123
1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine (PubChem CID 111342123) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine.
| Compound Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111342123 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 1-cyclohexyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-indol-1-ylpropyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCCCn2ccc3ccccc32)NC2CCCCC2)n1C |
| InChI | InChI=1S/C23H33N7/c1-18-27-28-22(29(18)2)17-25-23(26-20-10-4-3-5-11-20)24-14-8-15-30-16-13-19-9-6-7-12-21(19)30/h6-7,9,12-13,16,20H,3-5,8,10-11,14-15,17H2,1-2H3,(H2,24,25,26) |
| InChIKey | VIEUEBHCYGVSCZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|