C13H24N6S — CID 111495548
1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)guanidine (PubChem CID 111495548) has the molecular formula C13H24N6S and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)guanidine.
| Compound Name | 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111495548 |
| Molecular Formula | C13H24N6S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-cyclopropyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methylsulfanylpropyl)guanidine |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)NC1CC1 |
| InChI | InChI=1S/C13H24N6S/c1-10-17-18-12(19(10)2)9-15-13(16-11-5-6-11)14-7-4-8-20-3/h11H,4-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | OUVHCTVCHTYFPA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|