C16H31N7OS — CID 111843150
N-tert-butyl-2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]acetamide (PubChem CID 111843150) has the molecular formula C16H31N7OS and a molecular weight of 369.54 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111843150 |
| Molecular Formula | C16H31N7OS |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-tert-butyl-2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)carbamimidoyl]amino]acetamide |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H31N7OS/c1-12-21-22-13(23(12)5)10-18-15(17-8-7-9-25-6)19-11-14(24)20-16(2,3)4/h7-11H2,1-6H3,(H,20,24)(H2,17,18,19) |
| InChIKey | WEWUNQLGJNHRAA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|