C19H37N7S — CID 111841750
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-piperidin-1-ylpropyl)-3-(3-methylsulfanylpropyl)guanidine (PubChem CID 111841750) has the molecular formula C19H37N7S and a molecular weight of 395.62 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-piperidin-1-ylpropyl)-3-(3-methylsulfanylpropyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-piperidin-1-ylpropyl)-3-(3-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111841750 |
| Molecular Formula | C19H37N7S |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-piperidin-1-ylpropyl)-3-(3-methylsulfanylpropyl)guanidine |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C19H37N7S/c1-16-23-24-17(25(16)4)14-21-18(20-10-9-13-27-5)22-15-19(2,3)26-11-7-6-8-12-26/h6-15H2,1-5H3,(H2,20,21,22) |
| InChIKey | SWSKLQDXILLXJE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|