C22H35N7S — CID 111841786
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylsulfanylpropyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111841786) has the molecular formula C22H35N7S and a molecular weight of 429.64 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylsulfanylpropyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylsulfanylpropyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111841786 |
| Molecular Formula | C22H35N7S |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylsulfanylpropyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C22H35N7S/c1-18-26-27-21(28(18)2)17-25-22(23-12-9-15-30-3)24-16-20(29-13-7-8-14-29)19-10-5-4-6-11-19/h4-6,10-11,20H,7-9,12-17H2,1-3H3,(H2,23,24,25) |
| InChIKey | MRFHFRJABURGPV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|