C21H36IN7OS — CID 111770421
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111770421) has the molecular formula C21H36IN7OS and a molecular weight of 561.54 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111770421 |
| Molecular Formula | C21H36IN7OS |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-(3-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C21H35N7OS.HI/c1-17-25-26-20(27(17)2)16-24-21(22-10-8-14-30-3)23-15-18(19-9-7-13-29-19)28-11-5-4-6-12-28;/h7,9,13,18H,4-6,8,10-12,14-16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | CKPSBODBIGXDRD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|