C18H30IN7S — CID 111011974
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111011974) has the molecular formula C18H30IN7S and a molecular weight of 503.46 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111011974 |
| Molecular Formula | C18H30IN7S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-ethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C18H29N7S.HI/c1-4-19-18(21-13-17-23-22-14(2)24(17)3)20-12-15(16-8-7-11-26-16)25-9-5-6-10-25;/h7-8,11,15H,4-6,9-10,12-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | HCXQMSBHDOCMNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|