C20H32IN5S2 — CID 111834346
1-ethyl-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111834346) has the molecular formula C20H32IN5S2 and a molecular weight of 533.55 g/mol. Its IUPAC name is 1-ethyl-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111834346 |
| Molecular Formula | C20H32IN5S2 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 1-ethyl-2-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(C(C)C)n1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C20H31N5S2.HI/c1-4-21-20(22-12-16-14-27-19(24-16)15(2)3)23-13-17(18-8-7-11-26-18)25-9-5-6-10-25;/h7-8,11,14-15,17H,4-6,9-10,12-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | RDQIWKMYMIUUJW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|